The oxalate phosphates are chemical compounds containing oxalate and phosphate anions. They are also called oxalatophosphates or phosphate oxalates. Some oxalate-phosphate minerals found in bat guano deposits are known. [1] Oxalate phosphates can form metal organic framework compounds.
Related compounds include the arsenate oxalates, [2] [3] and phosphite oxalates, [4] oxalatomethylphosphonate, [5] and potentially other oxalate phosphonates.
name | chem | mw | crystal system | space group | unit cell Å | volume | density | comment | references |
---|---|---|---|---|---|---|---|---|---|
Phoxite | (NH4)2Mg2(C2O4)(PO3OH)2(H2O)4 | monoclinic | P21/c | a=7.2962 b=13.5993 c=7.8334 β=108.271° Z=2 | 738.07 | 1.98 | mineral biaxial(-) α = 1.499, β = 1.541 γ = 1.542; 2V = 16 | [6] | |
Thebaite-(NH4) | (NH4,K)3Al(C2O4)(PO3OH)2(H2O) | monoclinic | P21/c | a = 11.156, b = 6.234, c = 18.65, β = 102.93°, Z=4 | 1264 | 2.093 | biaxial (–) α = 1.490, β = 1.534, γ = 1.570; 2V = 82.7° | [7] | |
bis(N-methylpiperazinedi-ium) bis(bis(μ-dihydrogen phosphato)-(oxalato)-scandium) oxalate trihydrate | H2mpip⋅Sc(H2PO4)2(C2O4)·0.5C2O4·1.5H2O | C2 | a=17.1307 b=6.6277 c=16.3543 β=103.336° | [8] | |||||
Davidbrownite-(NH4) | (NH4), (NH4,K)5(V4+O)2(C2O4)[PO4H]3·[PO4H2]·3H2O | monoclinic | P21/c | a = 10.356, b = 8.923, c = 13.486, β = 92.618°, Z = 2 | 1244.9 | 2.12 | green–blue mineral biaxial (+) α = 1.540, β = 1.550 γ = 1.582; 2V = 58.5 | [1] | |
(NH4)2[(VO)2(HPO4)2C2O4]·5H2O | [9] | ||||||||
Li2(VO)2(HPO4)2(C2O4) | [10] | ||||||||
Li2(VO)2(HPO4)2(C2O4)·6H2O | 535.84 | triclinic | a = 6.4133 b = 9.2173, c = 14.6206 α = 95.016°, β = 91.797°, γ = 107.7622°, and Z = 2 | 818.38 | 2.1743 | [10] | |||
Na2[(VO)2(HPO4)2C2O4].2H2O | monoclinic | P21 | a = 6.3534, b = 17.1614, c = 6.5632, β = 106.59 | sheet morphology | [9] [11] | ||||
K2[(VO)2(HPO4)2(C2O4)] | 492.05 | triclinic | a=6.316 b=7.489 c=10.861 α=56.8° β=57.99° γ=54.20° | [12] | |||||
K2[(VO)2(HPO4)2(C2O4)]·4.5H2O | triclinic | P1 | a = 6.3953, b = 9.1451, c = 14.6208, α = 97.269°, β = 91.351° γ = 106.500° Z=2 | [12] | |||||
K2.5[(VO)2(HPO4)1.5(PO4)0.5(C2O4)] | MOF | [13] | |||||||
LiK[(VO)2(HPO4)2(C2O4)]·4.5H2O | [13] | ||||||||
(C2H10N2)[VO(HPO4)]2(C2O4) | 473.96 | triclinic | P1 | a = 6.3595, b = 6.6236, c = 9.224, α = 98.216o, β = 108.128o, γ = 100.672o, Z = 1 | 354.42 | 2.225 | [14] | ||
guanidine vanadyl hydrogenphosphate oxalate | (CH6N3)2[VO(HPO4)]2(C2O4) | 532.02 | triclinic | P1 | a = 6.3825, b = 7.8877, c = 9.202, α = 66.602o, β = 71.757o, γ = 79.821o, Z = 1 | 403.07 | 2.192 | [14] | |
catena-(4,4'-Bipyridinium bis(μ3-hydrogen phosphato)-(μ2-oxalato)-dioxo-di-vanadium) | (C10H10N2)[(VO)(HPO4)]2(C2O4) | monoclinic | P21/c | a=9.250 b=6.338 c=16.111, β=98.08° | [15] | ||||
K2MnII2(H2O)2C2O4(HPO3)2 | oxalophosphite | [16] | |||||||
TREN = tris(2-aminoethyl)amine) | (H3TREN)[Mn2(HPO4)(C2O4)2.5]·3H2O | triclinic | P1 | a = 8.8385, b = 9.0586, c = 16.020, α = 77.616°, β = 83.359°, γ = 68.251°, and Z = 2. | [17] | ||||
mpip1-methylpiperazine | (H2mpip)1.5•Mn3(HPO4)(H2PO4)(C2O4)2 | [18] | |||||||
dap=1,2-diaminopropane | (H2dap)•Mn3(HPO4)(H2PO4)(C2O4)2 | [18] | |||||||
pa=propylamine | (Hpa)•Mn3(HPO4)(H2PO4)(C2O4)2 | [18] | |||||||
dmp = 1,4-dimethylpiperazine | (H2dmp)0.5·Mn(H2PO4)(C2O4) | triclinic | P1 | a =5.8528 b =8.1833 c =11.1334, α =103.958° β =93.550° γ =90.572° | [19] | ||||
TREN = tris(2-aminoethyl)amine) | (H3TREN)[Fe2(HPO4)(C2O4)2.5]·3H2O | triclinic | P1 | a = 8.7776, b = 8.9257, c = 15.884, α = 78.630°, β = 84.018°, and γ = 67.372° Z=2 | [17] | ||||
1,3-diaminopropane | [C3H12N22[Fe5(C2O4)2(HxPO4)8] | 1367.31 | triclinic | P1 | a=9.7851 b=9.8986 c=10.7420 α =73.790 β = 71.684 γ = 79.300 Z=1 | 942.99 | 2.408 | [20] | |
Na2Fe(C2O4)(HPO4) | monoclinic | P21/c | a=6.4728, b=20.210, c=10.4712 β=90.745 | 1369.7 | orange | [21] | |||
K2Fe(C2O4)(HPO4)(OH2) · H2O | 354.08 | orthorhombic | Pbca | a=11.880 b=10.384 c=15.337 Z=8 | 1891.9 | 2.486 | yellow | [22] | |
[NH3(CH2)3NH3][Zn6(PO4)4(C2O4)] | 456.12 | triclinic | P1 | a =5.0030 b=8.5434 c=12.4336 α=92.99 β=97.138 γ = 91.465 Z=2 | 526.33 | 2.878 | [23] | ||
MIL-90 pentagallium sesquitrimethylenediamine difluoride dihydroxy oxalate tetraphosphate | Ga5(PO4)4(C2O4)F2(OH)2·1.5N2C3H12 | triclinic | P1 | a = 8.1217, b = 8.9601, c = 10.4611, α = 111.930°, β = 103.655°, γ = 101.903° | 648.59 | [24] | |||
NTHU-6 | 2(C13H16N2) Ga10 8(PO4)(HPO4)4(OH)2(C2O4).3(H2O) | 2251.61 | monoclinic | C2/m | a=23.048 b=24.649 c=17.081 β = 132.192 Z=4 | 7189.8 | 2.080 | yellow | [25] |
1,3-diaminopropane | [Ga2(PO4)2(H2O)(C2O4)0.5](C3N2H12)0.5(H2O) | [26] | |||||||
ethylene diamine | [Ga2(PO4)2(C2O4)0.5](C2N2H10)0.5(H2O) | [26] | |||||||
1,3-diaminopropane | [Ga2(PO4)2(C2O4)0.5](C3N2H12)0.5 | [26] | |||||||
diethylene triamine | [Ga2(PO4)2(H2PO4)0.5(C2O4)0.5](C4N3H16)0.5 (H2O)1.5 | [26] | |||||||
diethylene triamine | [Ga2.5(PO4)2.5(H2O)1.5(C2O4)0.5](C4N3H15)0.5 | [26] | |||||||
dmpip = 2,6-dimethyl-piperazine
catena-(bis(2,6-dimethylpiperazine-1,4-di-ium) bis(μ-hydrogen phosphato)-bis(μ-phosphato)-(μ-oxalato)-bis(hydrogen phosphato)-tetra-gallium dihydrate |
[H2dmpip][Ga2(HPO4)2(PO4)(C2O4)0.5]·H2O | monoclinic | P21/c | a 8.904 b 28.036 c 8.173, β =100.74° | [27] | ||||
catena-(2-(3-ammoniopropyl)propane-1,3-diammonium bis(μ4-phosphato)-bis(μ3-phosphato)-(μ2-oxalato)-(μ2-monohydrogen phosphato)-tetra-gallium dihydrate) | [C6N3H19][Ga4(C2O4)(PO4)4(H2PO4)]·2H2O | monoclinic | C2/c | a =20.355 b =15.649 c =9.0517 β =105.781° | [28] | ||||
Piperazinediium bis(μ2-oxalato-O,O',O'',O''')-bis(μ2-hydrogen phosphato-O,O')-diaqua-di-indium dihydrate | [C4N2H12]0.5In(HPO4)(C2O4).H2O | monoclinic | P21/c | a =6.4726 b =11.080 c =14.311, β =100.316° | [29] | ||||
Piperazinium bis(μ3-monhydrogenphosphato)-(μ2-monohydrogenphosphato)-(μ2-oxalato)-di-indium monohydrate | [C4H12N2][In2(C2O4)(HPO4)3]·H2O | monoclinic | P21 | a =6.5052 b =17.5005 c =8.1811 β =107.656 | [30] | ||||
dmp = 1,4-dimethylpiperazine
bis(1,4-dimethylpiperazine-1,4-diium) bis(μ-oxalato)-tetrakis(μ-dihydrogen phosphato)-tetrakis(μ-hydrogen phosphato)-tetra-indium(iii) dihydrate |
H2dmp·In2(HPO4)2(H2PO4)2(C2O4)·H2O | a 7.9684 b 11.9582 c 12.5204, α 89.946° β 84.035° γ 87.287° | [19] | ||||||
dmapa = 3-(dimethylamino)-1-propylamine | H2dmapa·In2(HPO4)2(H2PO4)2(C2O4)·H2O | a 7.8398 b 12.0428 c 12.4877, α 90.013° β 96.335° γ 92.640° | [19] | ||||||
Cs2Fe(C2O4)0.5(HPO4)2 | [31] | ||||||||
CsFe(C2O4)0.5(H2PO4)(HPO4) | [31] | ||||||||
APPIP = 1,4-bis(3-aminopropyl)piperazine | (H4APPIP)[Er3(C2O4)5.5(H2PO4)2]·5H2O | [32] | |||||||
APPIP = 1,4-bis(3-aminopropyl)piperazine | (H4APPIP)[Tm3(C2O4)5.5(H2PO4)2]·5H2O | [32] | |||||||
APPIP = 1,4-bis(3-aminopropyl)piperazine | (H4APPIP)[Yb3(C2O4)5.5(H2PO4)2]·5H2O | [32] | |||||||
APPIP = 1,4-bis(3-aminopropyl)piperazine | (H4APPIP)[Lu3(C2O4)5.5(H2PO4)2]·5H2O | [32] | |||||||
K4[Th(HPO4)2(C2O4)2(H2O)2]•4Н2O | [33] | ||||||||
Plutonium(IV) oxalatophosphate | ? | [34] |